//////////////////////////////////////////////////////////////////////////////// /// DISCLAIMER /// /// Copyright 2014-2016 ArangoDB GmbH, Cologne, Germany /// Copyright 2004-2014 triAGENS GmbH, Cologne, Germany /// /// Licensed under the Apache License, Version 2.0 (the "License"); /// you may not use this file except in compliance with the License. /// You may obtain a copy of the License at /// /// http://www.apache.org/licenses/LICENSE-2.0 /// /// Unless required by applicable law or agreed to in writing, software /// distributed under the License is distributed on an "AS IS" BASIS, /// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. /// See the License for the specific language governing permissions and /// limitations under the License. /// /// Copyright holder is ArangoDB GmbH, Cologne, Germany /// /// @author Esteban Lombeyda //////////////////////////////////////////////////////////////////////////////// #include "process-utils.h" #if defined(TRI_HAVE_MACOS_MEM_STATS) #include #include #endif #ifdef TRI_HAVE_SYS_PRCTL_H #include #endif #ifdef TRI_HAVE_MACH #include #include #include #include #include #include #endif #ifdef _WIN32 #include #include #endif #include "Logger/Logger.h" #include "Basics/MutexLocker.h" #include "Basics/StringBuffer.h" #include "Basics/StringUtils.h" #include "Basics/Thread.h" #include "Basics/tri-strings.h" using namespace arangodb; //////////////////////////////////////////////////////////////////////////////// /// @brief physical memory //////////////////////////////////////////////////////////////////////////////// uint64_t TRI_PhysicalMemory; //////////////////////////////////////////////////////////////////////////////// /// @brief all external processes //////////////////////////////////////////////////////////////////////////////// static std::vector ExternalProcesses; //////////////////////////////////////////////////////////////////////////////// /// @brief lock for protected access to vector ExternalProcesses //////////////////////////////////////////////////////////////////////////////// static arangodb::Mutex ExternalProcessesLock; ProcessInfo::ProcessInfo(): _minorPageFaults(0), _majorPageFaults(0), _userTime(0), _systemTime(0), _numberThreads(0), _residentSize(0), // resident set size in number of bytes _virtualSize(0), _scClkTck(0){} ExternalId::ExternalId(): #ifndef _WIN32 _pid(0), _readPipe(-1), _writePipe(-1) {} #else _pid(0), _readPipe(INVALID_HANDLE_VALUE), _writePipe(INVALID_HANDLE_VALUE) {} #endif ExternalProcess::ExternalProcess(): _numberArguments(0), _arguments(nullptr), #ifndef _WIN32 _pid(0), _readPipe(-1), _writePipe(-1), #else _pid(0), _process(nullptr), _readPipe(INVALID_HANDLE_VALUE), _writePipe(INVALID_HANDLE_VALUE), #endif _status(TRI_EXT_NOT_STARTED), _exitStatus(0) {} ExternalProcess::~ExternalProcess() { for (size_t i = 0; i < _numberArguments; i++) { if (_arguments[i] != nullptr) { TRI_Free(_arguments[i]); } } if (_arguments) { TRI_Free(_arguments); } #ifndef _WIN32 if (_readPipe != -1) { close(_readPipe); } if (_writePipe != -1) { close(_writePipe); } #else CloseHandle(_process); if (_readPipe != INVALID_HANDLE_VALUE) { CloseHandle(_readPipe); } if (_writePipe != INVALID_HANDLE_VALUE) { CloseHandle(_writePipe); } #endif } ExternalProcessStatus::ExternalProcessStatus(): _status(TRI_EXT_NOT_STARTED), _exitStatus(0), _errorMessage() {} //////////////////////////////////////////////////////////////////////////////// /// @brief creates pipe pair //////////////////////////////////////////////////////////////////////////////// #ifndef _WIN32 static bool CreatePipes(int* pipe_server_to_child, int* pipe_child_to_server) { if (pipe(pipe_server_to_child) == -1) { LOG_TOPIC(ERR, arangodb::Logger::FIXME) << "cannot create pipe"; return false; } if (pipe(pipe_child_to_server) == -1) { LOG_TOPIC(ERR, arangodb::Logger::FIXME) << "cannot create pipe"; close(pipe_server_to_child[0]); close(pipe_server_to_child[1]); return false; } return true; } //////////////////////////////////////////////////////////////////////////////// /// @brief starts external process //////////////////////////////////////////////////////////////////////////////// static void StartExternalProcess(ExternalProcess* external, bool usePipes) { int pipe_server_to_child[2]; int pipe_child_to_server[2]; if (usePipes) { bool ok = CreatePipes(pipe_server_to_child, pipe_child_to_server); if (!ok) { external->_status = TRI_EXT_PIPE_FAILED; return; } } int processPid = fork(); // child process if (processPid == 0) { // set stdin and stdout of child process if (usePipes) { dup2(pipe_server_to_child[0], 0); dup2(pipe_child_to_server[1], 1); fcntl(0, F_SETFD, 0); fcntl(1, F_SETFD, 0); fcntl(2, F_SETFD, 0); // close pipes close(pipe_server_to_child[0]); close(pipe_server_to_child[1]); close(pipe_child_to_server[0]); close(pipe_child_to_server[1]); } else { close(0); fcntl(1, F_SETFD, 0); fcntl(2, F_SETFD, 0); } // execute worker execvp(external->_executable.c_str(), external->_arguments); _exit(1); } // parent if (processPid == -1) { LOG_TOPIC(ERR, arangodb::Logger::FIXME) << "fork failed"; if (usePipes) { close(pipe_server_to_child[0]); close(pipe_server_to_child[1]); close(pipe_child_to_server[0]); close(pipe_child_to_server[1]); } external->_status = TRI_EXT_FORK_FAILED; return; } LOG_TOPIC(DEBUG, arangodb::Logger::FIXME) << "fork succeeded, child pid: " << processPid; if (usePipes) { close(pipe_server_to_child[0]); close(pipe_child_to_server[1]); external->_writePipe = pipe_server_to_child[1]; external->_readPipe = pipe_child_to_server[0]; } else { external->_writePipe = -1; external->_readPipe = -1; } external->_pid = processPid; external->_status = TRI_EXT_RUNNING; } #else static bool createPipes(HANDLE* hChildStdinRd, HANDLE* hChildStdinWr, HANDLE* hChildStdoutRd, HANDLE* hChildStdoutWr) { // set the bInheritHandle flag so pipe handles are inherited SECURITY_ATTRIBUTES saAttr; saAttr.nLength = sizeof(SECURITY_ATTRIBUTES); saAttr.bInheritHandle = TRUE; saAttr.lpSecurityDescriptor = NULL; // create a pipe for the child process's STDOUT if (!CreatePipe(hChildStdoutRd, hChildStdoutWr, &saAttr, 0)) { LOG_TOPIC(ERR, arangodb::Logger::FIXME) << "" << "stdout pipe creation failed"; return false; } // create a pipe for the child process's STDIN if (!CreatePipe(hChildStdinRd, hChildStdinWr, &saAttr, 0)) { CloseHandle(hChildStdoutRd); CloseHandle(hChildStdoutWr); LOG_TOPIC(ERR, arangodb::Logger::FIXME) << "stdin pipe creation failed"; return false; } return true; } #define appendChar(buf, x) \ do { \ err = TRI_AppendCharStringBuffer((buf), (x)); \ if (err != TRI_ERROR_NO_ERROR) { \ return err; \ } \ } while (false); static int appendQuotedArg(TRI_string_buffer_t* buf, char const* p) { int err; appendChar(buf, '"'); while (*p != 0) { unsigned int i; unsigned int NumberBackslashes = 0; char const* q = p; while (*q == '\\') { ++q; ++NumberBackslashes; } if (*q == 0) { // Escape all backslashes, but let the terminating // double quotation mark we add below be interpreted // as a metacharacter. for (i = 0; i < NumberBackslashes; i++) { appendChar(buf, '\\'); appendChar(buf, '\\'); } break; } else if (*q == '"') { // Escape all backslashes and the following // double quotation mark. for (i = 0; i < NumberBackslashes; i++) { appendChar(buf, '\\'); appendChar(buf, '\\'); } appendChar(buf, '\\'); appendChar(buf, *q); } else { // Backslashes aren't special here. for (i = 0; i < NumberBackslashes; i++) { appendChar(buf, '\\'); } appendChar(buf, *q); } p = ++q; } appendChar(buf, '"'); return TRI_ERROR_NO_ERROR; } static char* makeWindowsArgs(ExternalProcess* external) { TRI_string_buffer_t* buf; size_t i; int err = TRI_ERROR_NO_ERROR; char* res; buf = TRI_CreateStringBuffer(); if (buf == nullptr) { return nullptr; } TRI_ReserveStringBuffer(buf, 1024); err = appendQuotedArg(buf, external->_executable.c_str()); if (err != TRI_ERROR_NO_ERROR) { TRI_FreeStringBuffer(buf); return nullptr; } for (i = 1; i < external->_numberArguments; i++) { err = TRI_AppendCharStringBuffer(buf, ' '); if (err != TRI_ERROR_NO_ERROR) { TRI_FreeStringBuffer(buf); return nullptr; } err = appendQuotedArg(buf, external->_arguments[i]); } res = TRI_StealStringBuffer(buf); TRI_FreeStringBuffer(buf); return res; } static bool startProcess(ExternalProcess* external, HANDLE rd, HANDLE wr) { char* args; PROCESS_INFORMATION piProcInfo; STARTUPINFO siStartInfo; BOOL bFuncRetn = FALSE; TRI_ERRORBUF; args = makeWindowsArgs(external); if (args == nullptr) { LOG_TOPIC(ERR, arangodb::Logger::FIXME) << "execute of '" << external->_executable << "' failed making args"; return false; } // set up members of the PROCESS_INFORMATION structure ZeroMemory(&piProcInfo, sizeof(PROCESS_INFORMATION)); // set up members of the STARTUPINFO structure ZeroMemory(&siStartInfo, sizeof(STARTUPINFO)); siStartInfo.cb = sizeof(STARTUPINFO); siStartInfo.dwFlags = STARTF_USESTDHANDLES; siStartInfo.hStdInput = rd ? rd : nullptr; siStartInfo.hStdOutput = wr ? wr : GetStdHandle(STD_OUTPUT_HANDLE); siStartInfo.hStdError = GetStdHandle(STD_ERROR_HANDLE); // create the child process bFuncRetn = CreateProcess(NULL, args, // command line NULL, // process security attributes NULL, // primary thread security attributes TRUE, // handles are inherited CREATE_NEW_PROCESS_GROUP, // creation flags NULL, // use parent's environment NULL, // use parent's current directory &siStartInfo, // STARTUPINFO pointer &piProcInfo); // receives PROCESS_INFORMATION TRI_Free(args); if (bFuncRetn == FALSE) { TRI_SYSTEM_ERROR(); LOG_TOPIC(ERR, arangodb::Logger::FIXME) << "execute of '" << external->_executable << "' failed, error: " << GetLastError() << " " << TRI_GET_ERRORBUF; return false; } else { external->_pid = piProcInfo.dwProcessId; external->_process = piProcInfo.hProcess; CloseHandle(piProcInfo.hThread); return true; } } static void StartExternalProcess(ExternalProcess* external, bool usePipes) { HANDLE hChildStdinRd = NULL, hChildStdinWr = NULL; HANDLE hChildStdoutRd = NULL, hChildStdoutWr = NULL; bool fSuccess; if (usePipes) { fSuccess = createPipes(&hChildStdinRd, &hChildStdinWr, &hChildStdoutRd, &hChildStdoutWr); if (!fSuccess) { external->_status = TRI_EXT_PIPE_FAILED; return; } } // now create the child process. fSuccess = startProcess(external, hChildStdinRd, hChildStdoutWr); if (!fSuccess) { external->_status = TRI_EXT_FORK_FAILED; if (hChildStdoutRd != NULL) { CloseHandle(hChildStdoutRd); } if (hChildStdoutWr != NULL) { CloseHandle(hChildStdoutWr); } if (hChildStdinRd != NULL) { CloseHandle(hChildStdinRd); } if (hChildStdinWr != NULL) { CloseHandle(hChildStdinWr); } return; } CloseHandle(hChildStdinRd); CloseHandle(hChildStdoutWr); external->_readPipe = hChildStdoutRd; external->_writePipe = hChildStdinWr; external->_status = TRI_EXT_RUNNING; } #endif void TRI_LogProcessInfoSelf(char const* message) { ProcessInfo info = TRI_ProcessInfoSelf(); if (message == nullptr) { message = ""; } LOG_TOPIC(TRACE, Logger::MEMORY) << message << "virtualSize: " << info._virtualSize << ", residentSize: " << info._residentSize << ", numberThreads: " << info._numberThreads; } //////////////////////////////////////////////////////////////////////////////// /// @brief converts usec and sec into seconds //////////////////////////////////////////////////////////////////////////////// #ifdef ARANGODB_HAVE_GETRUSAGE uint64_t TRI_MicrosecondsTv(struct timeval* tv) { time_t sec = tv->tv_sec; suseconds_t usec = tv->tv_usec; while (usec < 0) { usec += 1000000; sec -= 1; } return (sec * 1000000LL) + usec; } #endif //////////////////////////////////////////////////////////////////////////////// /// @brief returns information about the current process //////////////////////////////////////////////////////////////////////////////// #ifdef TRI_HAVE_LINUX_PROC ProcessInfo TRI_ProcessInfoSelf() { return TRI_ProcessInfo(Thread::currentProcessId()); } #elif ARANGODB_HAVE_GETRUSAGE ProcessInfo TRI_ProcessInfoSelf() { ProcessInfo result; result._scClkTck = 1000000; struct rusage used; int res = getrusage(RUSAGE_SELF, &used); if (res == 0) { result._minorPageFaults = used.ru_minflt; result._majorPageFaults = used.ru_majflt; result._systemTime = TRI_MicrosecondsTv(&used.ru_stime); result._userTime = TRI_MicrosecondsTv(&used.ru_utime); // ru_maxrss is the resident set size in kilobytes. need to multiply with // 1024 to get the number of bytes result._residentSize = used.ru_maxrss * ARANGODB_GETRUSAGE_MAXRSS_UNIT; } #ifdef TRI_HAVE_MACH { kern_return_t rc; thread_array_t array; mach_msg_type_number_t count; rc = task_threads(mach_task_self(), &array, &count); if (rc == KERN_SUCCESS) { unsigned int i; result._numberThreads = count; for (i = 0; i < count; ++i) { mach_port_deallocate(mach_task_self(), array[i]); } vm_deallocate(mach_task_self(), (vm_address_t)array, sizeof(thread_t) * count); } } { kern_return_t rc; struct task_basic_info t_info; mach_msg_type_number_t t_info_count = TASK_BASIC_INFO_COUNT; rc = task_info(mach_task_self(), TASK_BASIC_INFO, (task_info_t)&t_info, &t_info_count); if (rc == KERN_SUCCESS) { result._virtualSize = t_info.virtual_size; result._residentSize = t_info.resident_size; } else { result._virtualSize = 0; result._residentSize = 0; } } #endif return result; } #else /// -------------------------------------------- /// transform a file time to timestamp /// Particularities: /// 1. FileTime can save a date at Jan, 1 1601 /// timestamp saves dates at 1970 /// -------------------------------------------- static uint64_t _TimeAmount(FILETIME* ft) { uint64_t ts, help; ts = ft->dwLowDateTime; help = ft->dwHighDateTime; help = help << 32; ts |= help; /// at moment without transformation return ts; } static time_t _FileTime_to_POSIX(FILETIME* ft) { LONGLONG ts, help; ts = ft->dwLowDateTime; help = ft->dwHighDateTime; help = help << 32; ts |= help; return (ts - 116444736000000000) / 10000000; } ProcessInfo TRI_ProcessInfoSelf() { ProcessInfo result; PROCESS_MEMORY_COUNTERS_EX pmc; pmc.cb = sizeof(PROCESS_MEMORY_COUNTERS_EX); // compiler warning wird in kauf genommen!c // http://msdn.microsoft.com/en-us/library/windows/desktop/ms684874(v=vs.85).aspx if (GetProcessMemoryInfo(GetCurrentProcess(), (PPROCESS_MEMORY_COUNTERS)&pmc, pmc.cb)) { result._majorPageFaults = pmc.PageFaultCount; // there is not any corresponce to minflt in linux result._minorPageFaults = 0; // from MSDN: // "The working set is the amount of memory physically mapped to the process // context at a given time. // Memory in the paged pool is system memory that can be transferred to the // paging file on disk(paged) when // it is not being used. Memory in the nonpaged pool is system memory that // cannot be paged to disk as long as // the corresponding objects are allocated. The pagefile usage represents // how much memory is set aside for the // process in the system paging file. When memory usage is too high, the // virtual memory manager pages selected // memory to disk. When a thread needs a page that is not in memory, the // memory manager reloads it from the // paging file." result._residentSize = pmc.WorkingSetSize; result._virtualSize = pmc.PrivateUsage; } /// computing times FILETIME creationTime, exitTime, kernelTime, userTime; if (GetProcessTimes(GetCurrentProcess(), &creationTime, &exitTime, &kernelTime, &userTime)) { // see remarks in // http://msdn.microsoft.com/en-us/library/windows/desktop/ms683223(v=vs.85).aspx // value in seconds result._scClkTck = 10000000; // 1e7 result._systemTime = _TimeAmount(&kernelTime); result._userTime = _TimeAmount(&userTime); // for computing the timestamps of creation and exit time // the function '_FileTime_to_POSIX' should be called } /// computing number of threads DWORD myPID = GetCurrentProcessId(); HANDLE snapShot = CreateToolhelp32Snapshot(TH32CS_SNAPTHREAD, myPID); if (snapShot != INVALID_HANDLE_VALUE) { THREADENTRY32 te32; te32.dwSize = sizeof(THREADENTRY32); if (Thread32First(snapShot, &te32)) { result._numberThreads++; while (Thread32Next(snapShot, &te32)) { if (te32.th32OwnerProcessID == myPID) { result._numberThreads++; } } } CloseHandle(snapShot); } return result; } #endif //////////////////////////////////////////////////////////////////////////////// /// @brief returns information about the process //////////////////////////////////////////////////////////////////////////////// #ifdef TRI_HAVE_LINUX_PROC ProcessInfo TRI_ProcessInfo(TRI_pid_t pid) { //////////////////////////////////////////////////////////////////////////////// /// @brief contains all data documented by "proc" /// /// @see man 5 proc for the state of a process //////////////////////////////////////////////////////////////////////////////// typedef struct process_state_s { pid_t pid; /* size was choosen arbitrary */ char comm[128]; char state; int ppid; int pgrp; int session; int tty_nr; int tpgid; unsigned flags; /* lu */ unsigned long minflt; unsigned long cminflt; unsigned long majflt; unsigned long cmajflt; unsigned long utime; unsigned long stime; /* ld */ long cutime; long cstime; long priority; long nice; long num_threads; long itrealvalue; /* llu */ long long unsigned int starttime; /* lu */ unsigned long vsize; /* ld */ long rss; /* lu */ // cppcheck-suppress * unsigned long rsslim; // cppcheck-suppress * unsigned long startcode; // cppcheck-suppress * unsigned long endcode; // cppcheck-suppress * unsigned long startstack; // cppcheck-suppress * unsigned long kstkesp; // cppcheck-suppress * unsigned long signal; /* obsolete lu*/ // cppcheck-suppress * unsigned long blocked; // cppcheck-suppress * unsigned long sigignore; // cppcheck-suppress * unsigned int sigcatch; // cppcheck-suppress * unsigned long wchan; /* no maintained lu */ // cppcheck-suppress * unsigned long nswap; // cppcheck-suppress * unsigned long cnswap; /* d */ // cppcheck-suppress * int exit_signal; // cppcheck-suppress * int processor; /* u */ // cppcheck-suppress * unsigned rt_priority; // cppcheck-suppress * unsigned policy; /* llu */ // cppcheck-suppress * long long unsigned int delayacct_blkio_ticks; /* lu */ // cppcheck-suppress * unsigned long guest_time; /* ld */ // cppcheck-suppress * long cguest_time; } process_state_t; ProcessInfo result; char fn[1024]; snprintf(fn, sizeof(fn), "/proc/%d/stat", pid); int fd = open(fn, O_RDONLY); if (fd >= 0) { char str[1024]; process_state_t st; size_t n; memset(&str, 0, sizeof(str)); n = read(fd, str, sizeof(str)); close(fd); if (n == 0) { return result; } // fix process name in buffer. sadly, the process name might contain // whitespace // and the sscanf format '%s' will not honor that char* p = &str[0]; char* e = p + n; // first skip over the process id at the start of the string while (*p != '\0' && p < e && *p != ' ') { ++p; } // skip space if (p < e && *p == ' ') { ++p; } // check if filename is contained in parentheses if (p < e && *p == '(') { // yes ++p; // now replace all whitespace within the process name with underscores // otherwise the sscanf below will happily parse the string incorrectly while (p < e && *p != '0' && *p != ')') { if (*p == ' ') { *p = '_'; } ++p; } } // cppcheck-suppress * sscanf(str, "%d %s %c %d %d %d %d %d %u %lu %lu %lu %lu %lu %lu %ld %ld %ld %ld " "%ld %ld %llu %lu %ld", &st.pid, (char*)&st.comm, &st.state, &st.ppid, &st.pgrp, &st.session, &st.tty_nr, &st.tpgid, &st.flags, &st.minflt, &st.cminflt, &st.majflt, &st.cmajflt, &st.utime, &st.stime, &st.cutime, &st.cstime, &st.priority, &st.nice, &st.num_threads, &st.itrealvalue, &st.starttime, &st.vsize, &st.rss); result._minorPageFaults = st.minflt; result._majorPageFaults = st.majflt; result._userTime = st.utime; result._systemTime = st.stime; result._numberThreads = st.num_threads; // st.rss is measured in number of pages, we need to multiply by page size // to get the actual amount result._residentSize = st.rss * getpagesize(); result._virtualSize = st.vsize; result._scClkTck = sysconf(_SC_CLK_TCK); } return result; } #else ProcessInfo TRI_ProcessInfo(TRI_pid_t pid) { ProcessInfo result; result._scClkTck = 1; return result; } #endif //////////////////////////////////////////////////////////////////////////////// /// @brief sets the process name //////////////////////////////////////////////////////////////////////////////// void TRI_SetProcessTitle(char const* title) { #ifdef TRI_HAVE_SYS_PRCTL_H prctl(PR_SET_NAME, title, 0, 0, 0); #endif } //////////////////////////////////////////////////////////////////////////////// /// @brief starts an external process //////////////////////////////////////////////////////////////////////////////// void TRI_CreateExternalProcess(char const* executable, std::vector const& arguments, bool usePipes, ExternalId* pid) { size_t const n = arguments.size(); // create the external structure auto external = std::make_unique(); external->_executable = executable; external->_numberArguments = n + 1; external->_arguments = static_cast( TRI_Allocate((n + 2) * sizeof(char*))); if (external->_arguments == nullptr) { // gracefully handle out of memory pid->_pid = TRI_INVALID_PROCESS_ID; return; } memset(external->_arguments, 0, (n + 2) * sizeof(char*)); external->_arguments[0] = TRI_DuplicateString(executable); if (external->_arguments[0] == nullptr) { // OOM pid->_pid = TRI_INVALID_PROCESS_ID; return; } for (size_t i = 0; i < n; ++i) { external->_arguments[i + 1] = TRI_DuplicateString(arguments[i].c_str()); if (external->_arguments[i + 1] == nullptr) { // OOM pid->_pid = TRI_INVALID_PROCESS_ID; return; } } external->_arguments[n + 1] = nullptr; external->_status = TRI_EXT_NOT_STARTED; StartExternalProcess(external.get(), usePipes); if (external->_status != TRI_EXT_RUNNING) { pid->_pid = TRI_INVALID_PROCESS_ID; return; } LOG_TOPIC(DEBUG, arangodb::Logger::FIXME) << "adding process " << external->_pid << " to list"; // Note that the following deals with different types under windows, // however, this code here can be written in a platform-independent // way: pid->_pid = external->_pid; pid->_readPipe = external->_readPipe; pid->_writePipe = external->_writePipe; MUTEX_LOCKER(mutexLocker, ExternalProcessesLock); try { ExternalProcesses.push_back(external.get()); external.release(); } catch (...) { pid->_pid = TRI_INVALID_PROCESS_ID; return; } } //////////////////////////////////////////////////////////////////////////////// /// @brief returns the status of an external process //////////////////////////////////////////////////////////////////////////////// ExternalProcessStatus TRI_CheckExternalProcess(ExternalId pid, bool wait) { ExternalProcessStatus status; status._status = TRI_EXT_NOT_FOUND; status._exitStatus = 0; ExternalProcess* external = nullptr; { MUTEX_LOCKER(mutexLocker, ExternalProcessesLock); for (auto& it : ExternalProcesses) { if (it->_pid == pid._pid) { external = it; break; } } } if (external == nullptr) { status._errorMessage = std::string("the pid you're looking for is not in our list: ") + arangodb::basics::StringUtils::itoa(static_cast(pid._pid)); status._status = TRI_EXT_NOT_FOUND; LOG_TOPIC(WARN, arangodb::Logger::FIXME) << "checkExternal: pid not found: " << pid._pid; return status; } if (external->_status == TRI_EXT_RUNNING || external->_status == TRI_EXT_STOPPED) { #ifndef _WIN32 int opts; int loc = 0; if (wait) { opts = WUNTRACED; } else { opts = WNOHANG | WUNTRACED; } TRI_pid_t res = waitpid(external->_pid, &loc, opts); if (res == 0) { if (wait) { status._errorMessage = std::string("waitpid returned 0 for pid while it shouldn't ") + arangodb::basics::StringUtils::itoa(external->_pid); if (WIFEXITED(loc)) { external->_status = TRI_EXT_TERMINATED; external->_exitStatus = WEXITSTATUS(loc); } else if (WIFSIGNALED(loc)) { external->_status = TRI_EXT_ABORTED; external->_exitStatus = WTERMSIG(loc); } else if (WIFSTOPPED(loc)) { external->_status = TRI_EXT_STOPPED; external->_exitStatus = 0; } else { external->_status = TRI_EXT_ABORTED; external->_exitStatus = 0; } } else { external->_exitStatus = 0; } } else if (res == -1) { if (errno == ECHILD) { external->_status = TRI_EXT_NOT_FOUND; } TRI_set_errno(TRI_ERROR_SYS_ERROR); LOG_TOPIC(WARN, arangodb::Logger::FIXME) << "waitpid returned error for pid " << external->_pid << " (" << wait << "): " << TRI_last_error(); status._errorMessage = std::string("waitpid returned error for pid ") + arangodb::basics::StringUtils::itoa(external->_pid) + std::string(": ") + std::string(TRI_last_error()); } else if (static_cast(external->_pid) == static_cast(res)) { if (WIFEXITED(loc)) { external->_status = TRI_EXT_TERMINATED; external->_exitStatus = WEXITSTATUS(loc); } else if (WIFSIGNALED(loc)) { external->_status = TRI_EXT_ABORTED; external->_exitStatus = WTERMSIG(loc); } else if (WIFSTOPPED(loc)) { external->_status = TRI_EXT_STOPPED; external->_exitStatus = 0; } else { external->_status = TRI_EXT_ABORTED; external->_exitStatus = 0; } } else { LOG_TOPIC(WARN, arangodb::Logger::FIXME) << "unexpected waitpid result for pid " << external->_pid << ": " << res; status._errorMessage = std::string("unexpected waitpid result for pid ") + arangodb::basics::StringUtils::itoa(external->_pid) + std::string(": ") + arangodb::basics::StringUtils::itoa(res); } #else { char windowsErrorBuf[256]; bool wantGetExitCode = wait; if (wait) { DWORD result; result = WaitForSingleObject(external->_process, INFINITE); if (result == WAIT_FAILED) { FormatMessage(FORMAT_MESSAGE_FROM_SYSTEM, NULL, GetLastError(), 0, windowsErrorBuf, sizeof(windowsErrorBuf), NULL); LOG_TOPIC(WARN, arangodb::Logger::FIXME) << "could not wait for subprocess with pid " << external->_pid << ": " << windowsErrorBuf; status._errorMessage = std::string("could not wait for subprocess with pid ") + arangodb::basics::StringUtils::itoa( static_cast(external->_pid)) + windowsErrorBuf; status._exitStatus = GetLastError(); } } else { DWORD result; result = WaitForSingleObject(external->_process, 0); switch (result) { case WAIT_ABANDONED: wantGetExitCode = true; LOG_TOPIC(WARN, arangodb::Logger::FIXME) << "WAIT_ABANDONED while waiting for subprocess with pid " << external->_pid; break; case WAIT_OBJECT_0: /// this seems to be the exit case - want getExitCodeProcess here. wantGetExitCode = true; break; case WAIT_TIMEOUT: // success - everything went well. external->_exitStatus = 0; break; case WAIT_FAILED: FormatMessage(FORMAT_MESSAGE_FROM_SYSTEM, NULL, GetLastError(), 0, windowsErrorBuf, sizeof(windowsErrorBuf), NULL); LOG_TOPIC(WARN, arangodb::Logger::FIXME) << "could not wait for subprocess with pid " << external->_pid << ": " << windowsErrorBuf; status._errorMessage = std::string("could not wait for subprocess with PID '") + arangodb::basics::StringUtils::itoa( static_cast(external->_pid)) + std::string("'") + windowsErrorBuf; status._exitStatus = GetLastError(); default: wantGetExitCode = true; LOG_TOPIC(WARN, arangodb::Logger::FIXME) << "unexpected status while waiting for subprocess with pid " << external->_pid; } } if (wantGetExitCode) { DWORD exitCode = STILL_ACTIVE; if (!GetExitCodeProcess(external->_process, &exitCode)) { LOG_TOPIC(WARN, arangodb::Logger::FIXME) << "exit status could not be determined for pid " << external->_pid; status._errorMessage = std::string("exit status could not be determined for pid ") + arangodb::basics::StringUtils::itoa( static_cast(external->_pid)); } else { if (exitCode == STILL_ACTIVE) { external->_exitStatus = 0; } else if (exitCode > 255) { // this should be one of our signals which we mapped... external->_status = TRI_EXT_ABORTED; external->_exitStatus = exitCode - 255; } else { external->_status = TRI_EXT_TERMINATED; external->_exitStatus = exitCode; } } } else { external->_status = TRI_EXT_RUNNING; } } #endif } else { LOG_TOPIC(WARN, arangodb::Logger::FIXME) << "unexpected process status " << external->_status << ": " << external->_exitStatus; status._errorMessage = std::string("unexpected process status ") + arangodb::basics::StringUtils::itoa(external->_status) + std::string(": ") + arangodb::basics::StringUtils::itoa(external->_exitStatus); } status._status = external->_status; status._exitStatus = external->_exitStatus; // Do we have to free our data? if (external->_status != TRI_EXT_RUNNING && external->_status != TRI_EXT_STOPPED) { MUTEX_LOCKER(mutexLocker, ExternalProcessesLock); for (auto it = ExternalProcesses.begin(); it != ExternalProcesses.end(); ++it) { if ((*it)->_pid == pid._pid) { ExternalProcesses.erase(it); break; } } delete external; } return status; } //////////////////////////////////////////////////////////////////////////////// // @brief check for a process we didn't spawn, and check for access rights to // send it signals. #ifndef _WIN32 static ExternalProcess* getExternalProcess(TRI_pid_t pid) { if (kill(pid, 0) == 0) { ExternalProcess* external = new ExternalProcess(); if (external == nullptr) { // gracefully handle out of memory return nullptr; } external->_pid = pid; external->_status = TRI_EXT_RUNNING; return external; } LOG_TOPIC(WARN, arangodb::Logger::FIXME) << "checking for external process: '" << pid << "' failed with error: " << strerror(errno); return nullptr; } #else static ExternalProcess* getExternalProcess(TRI_pid_t pid) { HANDLE hProcess; hProcess = OpenProcess(PROCESS_ALL_ACCESS, FALSE, pid); if (hProcess != nullptr) { ExternalProcess* external = new ExternalProcess(); if (external == nullptr) { // gracefully handle out of memory return nullptr; } external->_pid = pid; external->_status = TRI_EXT_RUNNING; external->_process = hProcess; return external; } return nullptr; } #endif //////////////////////////////////////////////////////////////////////////////// // @brief check for a process we didn't spawn, and check for access rights to // send it signals. #ifndef _WIN32 static bool killProcess(ExternalProcess* pid, int signal) { TRI_ASSERT(pid != nullptr); if (kill(pid->_pid, signal) == 0) { return true; } return false; } #else static bool killProcess(ExternalProcess* pid, int signal) { TRI_ASSERT(pid != nullptr); UINT uExitCode = 0; // kill worker process if (0 != TerminateProcess(pid->_process, uExitCode)) { return true; } else { return false; } } #define SIGKILL 1 #endif #ifndef _WIN32 typedef enum e_sig_action { term, core, cont, ign, logrotate, stop, user } e_sig_action; //////////////////////////////////////////////////////////////////////////////// // @brief find out what impact a signal will have to the process we send it. static e_sig_action whatDoesSignal(int signal) { // Some platforms don't have these. To keep our table clean // we just define them here: #ifndef SIGPOLL #define SIGPOLL 23 #endif #ifndef SIGSTKFLT #define SIGSTKFLT 255 #endif #ifndef SIGPWR #define SIGPWR 29 #endif // Signal Value Action Comment // ──────────────────────────────────────────────────────────────────── switch (signal) { case SIGHUP: // 1 Term Hangup detected on controlling terminal return logrotate; // or death of controlling process // we say this is non-deadly since we should do a logrotate. case SIGINT: // 2 Term Interrupt from keyboard return term; case SIGQUIT: // 3 Core Quit from keyboard case SIGILL: // 4 Core Illegal Instruction case SIGABRT: // 6 Core Abort signal from abort(3) case SIGFPE: // 8 Core Floating-point exception case SIGSEGV: // 11 Core Invalid memory reference return core; case SIGKILL: // 9 Term Kill signal case SIGPIPE: // 13 Term Broken pipe: write to pipe with no // readers; see pipe(7) case SIGALRM: // 14 Term Timer signal from alarm(2) case SIGTERM: // 15 Term Termination signal case SIGUSR1: // 30,10,16 Term User-defined signal 1 case SIGUSR2: // 31,12,17 Term User-defined signal 2 return term; case SIGCHLD: // 20,17,18 Ign Child stopped or terminated return ign; case SIGCONT: // 19,18,25 Cont Continue if stopped return cont; case SIGSTOP: // 17,19,23 Stop Stop process case SIGTSTP: // 18,20,24 Stop Stop typed at terminal case SIGTTIN: // 21,21,26 Stop Terminal input for background process case SIGTTOU: // 22,22,27 Stop Terminal output for background process return stop; case SIGBUS: // 10,7,10 Core Bus error (bad memory access) return core; case SIGPOLL: // Term Pollable event (Sys V). return term; // Synonym for SIGIO case SIGPROF: // 27,27,29 Term Profiling timer expired return term; case SIGSYS: // 12,31,12 Core Bad system call (SVr4); // see also seccomp(2) case SIGTRAP: // 5 Core Trace/breakpoint trap return core; case SIGURG: // 16,23,21 Ign Urgent condition on socket (4.2BSD) return ign; case SIGVTALRM: // 26,26,28 Term Virtual alarm clock (4.2BSD) return term; case SIGXCPU: // 24,24,30 Core CPU time limit exceeded (4.2BSD); // see setrlimit(2) case SIGXFSZ: // 25,25,31 Core File size limit exceeded (4.2BSD); // see setrlimit(2) //case SIGIOT: // 6 Core IOT trap. A synonym for SIGABRT return core; //case SIGEMT: // 7,-,7 Term Emulator trap case SIGSTKFLT: // -,16,- Term Stack fault on coprocessor (unused) //case SIGIO: // 23,29,22 Term I/O now possible (4.2BSD) case SIGPWR: // 29,30,19 Term Power failure (System V) //case SIGINFO: // 29,-,- A synonym for SIGPWR //case SIGLOST: // -,-,- Term File lock lost (unused) return term; //case SIGCLD: // -,-,18 Ign A synonym for SIGCHLD case SIGWINCH: // 28,28,20 Ign Window resize signal (4.3BSD, Sun) return ign; //case SIGUNUSED: // -,31,- Core Synonymous with SIGSYS // return core; default: return user; } return term; } #endif bool TRI_IsDeadlySignal(int signal) { #ifndef _WIN32 switch (whatDoesSignal(signal)) { case term: return true; case core: return true; case cont: return false; case ign: return false; case logrotate: return false; case stop: return false; case user: // user signals aren't supposed to be deadly. return false; } #else // well windows... always deadly. #endif return true; } //////////////////////////////////////////////////////////////////////////////// /// @brief kills an external process //////////////////////////////////////////////////////////////////////////////// ExternalProcessStatus TRI_KillExternalProcess(ExternalId pid, int signal, bool isTerminal) { LOG_TOPIC(DEBUG, arangodb::Logger::FIXME) << "Sending process: " << pid._pid << " the signal: " << signal; ExternalProcess* external = nullptr; { MUTEX_LOCKER(mutexLocker, ExternalProcessesLock); for (auto it = ExternalProcesses.begin(); it != ExternalProcesses.end(); ++it) { if ((*it)->_pid == pid._pid) { external = (*it); break; } } } bool isChild = (external != nullptr); if (!isChild) { external = getExternalProcess(pid._pid); if (external == nullptr) { LOG_TOPIC(DEBUG, arangodb::Logger::FIXME) << "kill: process not found: " << pid._pid << " in our starting table and it doesn't exist."; ExternalProcessStatus status; status._status = TRI_EXT_NOT_FOUND; status._exitStatus = -1; return status; } LOG_TOPIC(DEBUG, arangodb::Logger::FIXME) << "kill: process not found: " << pid._pid << " in our starting table - adding"; // ok, we didn't spawn it, but now we claim the // ownership. MUTEX_LOCKER(mutexLocker, ExternalProcessesLock); try { ExternalProcesses.push_back(external); } catch (...) { delete external; ExternalProcessStatus status; status._status = TRI_EXT_NOT_FOUND; status._exitStatus = -1; return status; } } TRI_ASSERT(external != nullptr); if (killProcess(external, signal)) { external->_status = TRI_EXT_STOPPED; // if the process wasn't spawned by us, no waiting required. int count = 0; while (true) { ExternalProcessStatus status = TRI_CheckExternalProcess(pid, false); if (! isTerminal) { // we just sent a signal, don't care whether // the process is gone by now. return status; } if ((status._status == TRI_EXT_TERMINATED) || (status._status == TRI_EXT_ABORTED) || (status._status == TRI_EXT_NOT_FOUND)) { // Its dead and gone - good. MUTEX_LOCKER(mutexLocker, ExternalProcessesLock); for (auto it = ExternalProcesses.begin(); it != ExternalProcesses.end(); ++it) { if (*it == external) { ExternalProcesses.erase(it); break; } } if (!isChild && (status._status == TRI_EXT_NOT_FOUND) ) { status._status = TRI_EXT_TERMINATED; status._errorMessage.clear(); } return status; } sleep(1); if (count >= 8) { TRI_ASSERT(external != nullptr); killProcess(external, SIGKILL); } if (count > 20) { return status; } count ++; } } return TRI_CheckExternalProcess(pid, false); } //////////////////////////////////////////////////////////////////////////////// /// @brief stops an external process, only on Unix //////////////////////////////////////////////////////////////////////////////// bool TRI_SuspendExternalProcess(ExternalId pid) { LOG_TOPIC(DEBUG, arangodb::Logger::FIXME) << "suspending process: " << pid._pid; #ifndef _WIN32 return 0 == kill(pid._pid, SIGSTOP); #else return true; #endif } //////////////////////////////////////////////////////////////////////////////// /// @brief continues an external process, only on Unix //////////////////////////////////////////////////////////////////////////////// bool TRI_ContinueExternalProcess(ExternalId pid) { LOG_TOPIC(DEBUG, arangodb::Logger::FIXME) << "continueing process: " << pid._pid; #ifndef _WIN32 return 0 == kill(pid._pid, SIGCONT); #else return true; #endif } //////////////////////////////////////////////////////////////////////////////// /// @brief gets the physical memory //////////////////////////////////////////////////////////////////////////////// #if defined(TRI_HAVE_MACOS_MEM_STATS) static uint64_t GetPhysicalMemory() { int mib[2]; int64_t physicalMemory; size_t length; // Get the Physical memory size mib[0] = CTL_HW; #ifdef TRI_HAVE_MACOS_MEM_STATS mib[1] = HW_MEMSIZE; #else mib[1] = HW_PHYSMEM; // The bytes of physical memory. (kenel + user space) #endif length = sizeof(int64_t); sysctl(mib, 2, &physicalMemory, &length, nullptr, 0); return (uint64_t)physicalMemory; } #else #ifdef TRI_HAVE_SC_PHYS_PAGES static uint64_t GetPhysicalMemory() { long pages = sysconf(_SC_PHYS_PAGES); long page_size = sysconf(_SC_PAGE_SIZE); return (uint64_t)(pages * page_size); } #else #ifdef TRI_HAVE_WIN32_GLOBAL_MEMORY_STATUS static uint64_t GetPhysicalMemory() { MEMORYSTATUSEX status; status.dwLength = sizeof(status); GlobalMemoryStatusEx(&status); return (uint64_t)status.ullTotalPhys; } #endif // TRI_HAVE_WIN32_GLOBAL_MEMORY_STATUS #endif #endif //////////////////////////////////////////////////////////////////////////////// /// @brief initializes the process components //////////////////////////////////////////////////////////////////////////////// void TRI_InitializeProcess() { TRI_PhysicalMemory = GetPhysicalMemory(); } //////////////////////////////////////////////////////////////////////////////// /// @brief shuts down the process components //////////////////////////////////////////////////////////////////////////////// void TRI_ShutdownProcess() { MUTEX_LOCKER(mutexLocker, ExternalProcessesLock); for (auto* external : ExternalProcesses) { delete external; } ExternalProcesses.clear(); }